32265-82-0 Usage
Uses
Used in Organic Synthesis:
4-BROMO-2,6-DIMETHYLPHENYL ISOTHIOCYANATE is used as a synthetic intermediate for the creation of various organic compounds. Its reactivity towards nucleophiles allows for the formation of diverse chemical structures, making it a versatile building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-BROMO-2,6-DIMETHYLPHENYL ISOTHIOCYANATE is used as a key component in the development of new drugs or pharmaceuticals. Its unique chemical properties may contribute to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Used in Drug Design and Development:
4-BROMO-2,6-DIMETHYLPHENYL ISOTHIOCYANATE is employed as a structural element in drug design, potentially enhancing the pharmacological properties of new drug candidates. Its incorporation into drug molecules may improve their binding affinity, selectivity, and overall therapeutic potential.
Used in Chemical Research:
In the field of chemical research, 4-BROMO-2,6-DIMETHYLPHENYL ISOTHIOCYANATE serves as a subject of study for understanding the reactivity and behavior of isothiocyanate functional groups. This knowledge can be applied to the development of new synthetic methods and the exploration of novel chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 32265-82-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,2,6 and 5 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 32265-82:
(7*3)+(6*2)+(5*2)+(4*6)+(3*5)+(2*8)+(1*2)=100
100 % 10 = 0
So 32265-82-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BrNS/c1-6-3-8(10)4-7(2)9(6)11-5-12/h3-4H,1-2H3
