32448-35-4 Usage
Description
(2S)-2,6-diamino-5-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyhexanoic acid is a complex organic compound with a unique structure that features multiple hydroxyl and amino groups. It is characterized by its stereochemistry, with the 2S configuration at the central carbon and various hydroxyl and hydroxymethyl groups attached to the oxan rings. (2S)-2,6-diamino-5-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyhexanoic acid has potential applications in various fields due to its structural properties and functional groups.
Uses
1. Used in Pharmaceutical Applications:
(2S)-2,6-diamino-5-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyhexanoic acid is used as a potential therapeutic agent for various medical conditions. Its multiple hydroxyl and amino groups allow for interactions with biopolymers and macromolecules, making it a promising candidate for drug development.
2. Used in Diagnostic Applications:
In the field of diagnostics, (2S)-2,6-diamino-5-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyhexanoic acid can be used as a marker for bone formation and resorption processes. It is related to bone turnover during growth, development, and in metabolic bone diseases, making it a valuable tool for assessing bone health and monitoring treatment efficacy.
3. Used in Research Applications:
(2S)-2,6-diamino-5-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyhexanoic acid can also be utilized in research settings, particularly in the study of human mannan-binding proteins (MBPs). It is involved in reactions associated with the functional expression of MBPs in human cell lines transfected with MBP cDNA, providing insights into the role of these proteins in various biological processes.
4. Used in Drug Delivery Systems:
Similar to gallotannin, (2S)-2,6-diamino-5-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyhexanoic acid can be incorporated into drug delivery systems to enhance its bioavailability and therapeutic outcomes. The development of novel carriers, such as organic and metallic nanoparticles, can improve the delivery and efficacy of this compound in targeted applications.
Check Digit Verification of cas no
The CAS Registry Mumber 32448-35-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,4,4 and 8 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 32448-35:
(7*3)+(6*2)+(5*4)+(4*4)+(3*8)+(2*3)+(1*5)=104
104 % 10 = 4
So 32448-35-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H34N2O13/c19-4-2-1-3-7(20-30)17(29)33-18(15(28)13(26)11(24)9(6-22)32-18)16-14(27)12(25)10(23)8(5-21)31-16/h7-16,20-28,30H,1-6,19H2/t7-,8+,9+,10+,11-,12-,13-,14+,15+,16?,18?/m0/s1