324773-66-2 Usage
Uses
Used in Organic Electronics:
3-(3-Carbazol-9-yl-2-hydroxy-propylamino)-propan-1-ol is used as a component in organic electronics for its ability to contribute to the development of novel materials with enhanced electronic properties. The carbazole ring and the hydroxy and amino groups can participate in π-conjugation and charge transport, making it a promising candidate for organic semiconductors and other electronic devices.
Used in Pharmaceutical Industry:
3-(3-Carbazol-9-yl-2-hydroxy-propylamino)-propan-1-ol is used as a building block for the synthesis of pharmaceutical compounds due to its potential biological activity. The presence of hydroxy and amino groups can facilitate interactions with biological targets, such as enzymes or receptors, making it a valuable starting point for the development of new drugs with therapeutic applications.
Used in Chemical Synthesis:
3-(3-Carbazol-9-yl-2-hydroxy-propylamino)-propan-1-ol is used as an intermediate in the synthesis of other complex organic molecules. Its unique structure allows for further functionalization and modification, enabling the creation of a wide range of derivatives with tailored properties for specific applications in various industries, such as materials science, agrochemicals, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 324773-66-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,4,7,7 and 3 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 324773-66:
(8*3)+(7*2)+(6*4)+(5*7)+(4*7)+(3*3)+(2*6)+(1*6)=152
152 % 10 = 2
So 324773-66-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H22N2O2/c21-11-5-10-19-12-14(22)13-20-17-8-3-1-6-15(17)16-7-2-4-9-18(16)20/h1-4,6-9,14,19,21-22H,5,10-13H2/p+1/t14-/m1/s1
