325486-43-9 Usage
Description
2-BROMO-3,5-DIFLUOROPHENOL is an organic compound characterized by the presence of a bromo and two fluoro substituents on a phenol ring. This unique structure endows it with specific chemical properties that make it a valuable intermediate in various chemical reactions and synthesis processes.
Uses
Used in Pharmaceutical and Chemical Industries:
2-BROMO-3,5-DIFLUOROPHENOL is used as a key intermediate for the synthesis of unsymmetrical o-Biphenols and o-Binaphthols, which are important structural motifs in pharmaceuticals, agrochemicals, and advanced materials. The synthesis is achieved through a silicon-tethered Pd-catalyzed C-H arylation process, which allows for the efficient and selective formation of these valuable compounds.
This application is particularly significant because it enables the development of new and improved drugs, as well as the creation of innovative materials with unique properties. By facilitating the synthesis of complex organic molecules, 2-BROMO-3,5-DIFLUOROPHENOL plays a crucial role in advancing research and development efforts in these industries.
Check Digit Verification of cas no
The CAS Registry Mumber 325486-43-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,5,4,8 and 6 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 325486-43:
(8*3)+(7*2)+(6*5)+(5*4)+(4*8)+(3*6)+(2*4)+(1*3)=149
149 % 10 = 9
So 325486-43-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrF2O/c7-6-4(9)1-3(8)2-5(6)10/h1-2,10H
325486-43-9Relevant articles and documents
Aminoalkylbenzofurans as serotonin (5-HT(2c)) agonists
-
Page/Page column 33, (2010/11/08)
The present invention provides serotonergic aminoalkylbenzofurans of Formula (I): where R, R1, R2, R3, R4, R4′, R5, R5′, and R12 are as described in the specification.
