325491-81-4 Usage
Description
4-(2-METHYLTHIAZOL-4-YL)BUTAN-1-AMINE, also known as Pevonedistat, is a thiazole derivative chemical compound with significant pharmaceutical applications. It functions as a selective inhibitor of the NEDD8-activating enzyme (NAE), a crucial component in the ubiquitin-like protein modification process essential for the regulation of protein degradation. This makes Pevonedistat a promising agent in the development of cancer therapeutics due to its potential to disrupt protein homeostasis in cancer cells.
Uses
Used in Pharmaceutical Industry:
4-(2-METHYLTHIAZOL-4-YL)BUTAN-1-AMINE is used as a cancer therapeutic agent for its ability to selectively inhibit the NEDD8-activating enzyme, which plays a pivotal role in protein degradation. This inhibition can lead to the disruption of cellular processes in cancer cells, thereby exhibiting anti-cancer properties.
Used in Cancer Therapy:
Pevonedistat is utilized as a potential treatment for various types of cancer, including both solid tumors and hematologic malignancies. Its mechanism of action targets the NEDD8-activating enzyme, which is integral to the regulation of the cell cycle and apoptosis, processes often dysregulated in cancer cells.
Used in Combination Therapy:
4-(2-METHYLTHIAZOL-4-YL)BUTAN-1-AMINE is considered for use in combination therapy with other anti-cancer drugs. Its ability to inhibit NEDD8-activating enzyme can enhance the effectiveness of existing cancer treatments, particularly in cases where tumors have developed resistance to standard chemotherapy.
Check Digit Verification of cas no
The CAS Registry Mumber 325491-81-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,5,4,9 and 1 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 325491-81:
(8*3)+(7*2)+(6*5)+(5*4)+(4*9)+(3*1)+(2*8)+(1*1)=144
144 % 10 = 4
So 325491-81-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N2S/c1-7-10-8(6-11-7)4-2-3-5-9/h6H,2-5,9H2,1H3