32607-85-5 Usage
Uses
Used in Medicinal Chemistry and Pharmaceutical Research:
[2-(2-FLUORO-PHENYL)-ETHYL]-HYDRAZINE is used as a compound of interest in medicinal chemistry and pharmaceutical research for its potential to be developed into therapeutic agents. Its structural features may allow for the modulation of various biological targets, potentially leading to the discovery of new drugs for the treatment of various diseases.
Used in Organic Synthesis:
In the field of organic synthesis, [2-(2-FLUORO-PHENYL)-ETHYL]-HYDRAZINE serves as a valuable building block for the preparation of a wide range of functionalized compounds. Its unique structure can be utilized to create novel molecules with diverse applications, including but not limited to, pharmaceuticals, agrochemicals, and materials science.
Further Research and Studies:
Given the potential applications of [2-(2-FLUORO-PHENYL)-ETHYL]-HYDRAZINE, it is essential to conduct further research and studies to fully understand its properties, reactivity, and potential uses. This will enable the development of more targeted and effective applications in various industries, ultimately contributing to advancements in science and technology.
Check Digit Verification of cas no
The CAS Registry Mumber 32607-85-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,6,0 and 7 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 32607-85:
(7*3)+(6*2)+(5*6)+(4*0)+(3*7)+(2*8)+(1*5)=105
105 % 10 = 5
So 32607-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H11FN2/c9-8-4-2-1-3-7(8)5-6-11-10/h1-4,11H,5-6,10H2
