1-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethanone oxime is a complex organic compound with the molecular formula C11H11NO. It is derived from the bicyclo[4.2.0]octa-1,3,5-trien-7-yl group, which is a bicyclic aromatic system with a unique structure. 1-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethanone oxime is characterized by the presence of an oxime functional group, which is formed by the reaction of a carbonyl group with hydroxylamine. The oxime group is known for its ability to form stable complexes with metal ions, making it useful in analytical chemistry for the detection and quantification of certain metals. Additionally, oximes have applications in the synthesis of various pharmaceuticals and agrochemicals due to their reactivity and the potential for further functionalization. The compound's structure and properties make it a subject of interest in organic chemistry and potentially in the development of new materials and compounds.

3264-31-1

Post Buying Request

Basic information
1. Product Name: 1-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethanone oxime
2. Synonyms: 1-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethanone oxime
3. CAS NO:3264-31-1
4. Molecular Formula: C10H11NO
5. Molecular Weight: 161.22
6. EINECS: N/A
7. Product Categories: N/A
8. Mol File: 3264-31-1.mol
Chemical Properties
1. Melting Point: N/A
2. Boiling Point: 287.51°C (rough estimate)
3. Flash Point: 195.9°C
4. Appearance: /
5. Density: 1.0840 (rough estimate)
6. Vapor Pressure: 0.000131mmHg at 25°C
7. Refractive Index: 1.5200 (estimate)
8. Storage Temp.: N/A
9. Solubility: N/A
10. PKA: 11.90±0.10(Predicted)
11. CAS DataBase Reference: 1-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethanone oxime(CAS DataBase Reference)
12. NIST Chemistry Reference: 1-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethanone oxime(3264-31-1)
13. EPA Substance Registry System: 1-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethanone oxime(3264-31-1)
Safety Data
1. Hazard Codes: N/A
2. Statements: N/A
3. Safety Statements: N/A
4. WGK Germany:
5. RTECS:
6. HazardClass: N/A
7. PackingGroup: N/A
8. Hazardous Substances Data: 3264-31-1(Hazardous Substances Data)

Suppliers
Usage
Upstream product
Downstream Products

3264-31-1 Suppliers

Recommended suppliers

3264-31-1 Usage

Check Digit Verification of cas no

The CAS Registry Mumber 3264-31-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,6 and 4 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 3264-31:
(6*3)+(5*2)+(4*6)+(3*4)+(2*3)+(1*1)=71
71 % 10 = 1
So 3264-31-1 is a valid CAS Registry Number.

InChI:InChI=1/C10H11NO/c1-7(11-12)10-6-8-4-2-3-5-9(8)10/h2-5,10,12H,6H2,1H3/b11-7-

3264-31-1Upstream product

3264-31-1Downstream Products

Post a RFQ

Cas No.:

Product Name:

Quantity:

Email:

Company name:

Valid Period:

Detailed Requirements:

Enter 15 to 2000 letters.Word count: 0 letters

Attach files(File Format: Jpeg, Jpg, Gif, Png, PDF, PPT, Zip, Rar,Word or Excel Maximum File Size: 3MB)

What can I do for you?
Get Best Price

Get Best Price for 3264-31-1