3265-72-3 Usage
General Description
4,5,6,7-Tetrafluoro-2-methyl-1-benzofuran-3-carboxylic acid is a chemical compound with the molecular formula C10H5F4O3. It is a fluorinated derivative of benzofuran and is commonly used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and organic compounds. The presence of four fluorine atoms in its structure makes this compound highly stable and resistant to chemical reactions. It is also known for its unique properties, such as its high melting point and solubility in organic solvents. Due to its potential applications in the field of medicinal chemistry and materials science, 4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carboxylic acid is of interest to researchers and industries for further study and development.
Check Digit Verification of cas no
The CAS Registry Mumber 3265-72-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,6 and 5 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 3265-72:
(6*3)+(5*2)+(4*6)+(3*5)+(2*7)+(1*2)=83
83 % 10 = 3
So 3265-72-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H4F4O3/c1-2-3(10(15)16)4-5(11)6(12)7(13)8(14)9(4)17-2/h1H3,(H,15,16)
