3265-72-3 Usage
Uses
Used in Pharmaceutical Industry:
4,5,6,7-TETRAFLUORO-2-METHYL-1-BENZOFURAN-3-CARBOXYLIC ACID is used as a building block for the synthesis of various pharmaceuticals. Its unique structure and properties make it a valuable component in the development of new drugs with improved efficacy and stability.
Used in Agrochemical Industry:
In the agrochemical industry, 4,5,6,7-TETRAFLUORO-2-METHYL-1-BENZOFURAN-3-CARBOXYLIC ACID is used as a key intermediate in the production of various agrochemicals. Its stability and reactivity contribute to the development of effective and long-lasting agrochemical products.
Used in Organic Compounds Synthesis:
4,5,6,7-TETRAFLUORO-2-METHYL-1-BENZOFURAN-3-CARBOXYLIC ACID is used as a building block in the synthesis of various organic compounds. Its presence in the structure of these compounds can enhance their properties, such as stability, reactivity, and solubility, making them suitable for various applications in different industries.
Used in Medicinal Chemistry Research:
4,5,6,7-TETRAFLUORO-2-METHYL-1-BENZOFURAN-3-CARBOXYLIC ACID is used as a subject of research in the field of medicinal chemistry. Its unique properties and potential applications make it an interesting compound for the development of new drugs and therapeutic agents.
Used in Materials Science:
In materials science, 4,5,6,7-TETRAFLUORO-2-METHYL-1-BENZOFURAN-3-CARBOXYLIC ACID is used for the development of new materials with improved properties. Its high stability and solubility in organic solvents make it a valuable component in the synthesis of advanced materials for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3265-72-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,6 and 5 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 3265-72:
(6*3)+(5*2)+(4*6)+(3*5)+(2*7)+(1*2)=83
83 % 10 = 3
So 3265-72-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H4F4O3/c1-2-3(10(15)16)4-5(11)6(12)7(13)8(14)9(4)17-2/h1H3,(H,15,16)
