32773-97-0 Usage
Molecular structure
A complex structure consisting of a chromen-3-yl group, a formamido group, an oxo group, and a benzoic acid moiety.
Chromen-3-yl group
A known pharmacophore with various biological properties, which may contribute to the compound's potential biological activity.
Formamido group
A functional group that may also contribute to the compound's potential pharmacological effects.
Oxo group
A functional group present in the compound, which can influence its chemical properties and reactivity.
Benzoic acid moiety
A functional group that may contribute to the compound's potential pharmacological effects and solubility.
Potential biological activity
The compound may exhibit biological activity due to the presence of the chromen-3-yl group and other functional groups.
Further research needed
More studies are required to fully understand the properties, potential applications, and pharmacological effects of 2-(2-formamido-4-oxo-chromen-3-yl)oxybenzoic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 32773-97-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,7,7 and 3 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 32773-97:
(7*3)+(6*2)+(5*7)+(4*7)+(3*3)+(2*9)+(1*7)=130
130 % 10 = 0
So 32773-97-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H11NO6/c19-9-18-16-15(14(20)10-5-1-3-7-12(10)24-16)23-13-8-4-2-6-11(13)17(21)22/h1-9H,(H,18,19)(H,21,22)