32785-92-5 Usage
General Description
1-deoxyfructose, also known as 1-DF, is a naturally occurring sugar derivative that is chemically related to fructose. It is found in small amounts in some fruits and vegetables and is also produced as a byproduct during the caramelization of sugars. 1-deoxyfructose has been studied for its potential health benefits, including its antioxidant properties and its ability to inhibit the formation of advanced glycation end products (AGEs), which are associated with various diseases including diabetes and aging. Additionally, 1-deoxyfructose has been investigated for its potential as a food additive for its sweetening properties and low calorie content. However, further research is needed to fully understand the potential uses and benefits of 1-deoxyfructose.
Check Digit Verification of cas no
The CAS Registry Mumber 32785-92-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,7,8 and 5 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 32785-92:
(7*3)+(6*2)+(5*7)+(4*8)+(3*5)+(2*9)+(1*2)=135
135 % 10 = 5
So 32785-92-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h4-7,9-11H,2H2,1H3/t4-,5-,6-/m1/s1
