328-55-2 Usage
Uses
Used in Organic Synthesis:
2,6,7-trioxa-1-stibabicyclo[2.2.1]heptane is used as a building block in organic synthesis for its unique structure and reactivity, enabling the creation of complex organic molecules and compounds.
Used in Coordination Chemistry:
In coordination chemistry, 2,6,7-trioxa-1-stibabicyclo[2.2.1]heptane is utilized for its potential to form coordination complexes with metal ions, which can be applied in various areas such as catalysis and materials science.
Used in Catalysis:
2,6,7-trioxa-1-stibabicyclo[2.2.1]heptane serves as a catalyst or a catalyst precursor in various chemical reactions, leveraging its antimony center to facilitate transformations that are otherwise difficult to achieve.
Used in Pharmaceutical and Medicinal Chemistry:
2,6,7-trioxa-1-stibabicyclo[2.2.1]heptane has been studied for its potential use in pharmaceutical and medicinal chemistry, where its unique structural features may contribute to the development of new drugs and therapeutic agents.
Used in Chemical Research:
2,6,7-trioxa-1-stibabicyclo[2.2.1]heptane is also used in academic and industrial research settings to explore its properties and potential applications, further expanding the understanding of its role in chemical processes and reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 328-55-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,2 and 8 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 328-55:
(5*3)+(4*2)+(3*8)+(2*5)+(1*5)=62
62 % 10 = 2
So 328-55-2 is a valid CAS Registry Number.
InChI:InChI=1/C3H8O3.Sb/c4-1-3(6)2-5;/h3-6H,1-2H2;
