32813-48-2 Usage
Uses
Used in Pharmaceutical Industry:
4-[3-(4-MORPHOLINO)PROPYL]-3-THIOSEMICARBAZIDE is used as a precursor in the synthesis of various pharmaceutical compounds due to its diverse biological activities. Its antibacterial, antifungal, and antitumor properties make it a valuable component in the development of new drugs targeting infectious diseases and cancer.
Used in Biological Research:
4-[3-(4-MORPHOLINO)PROPYL]-3-THIOSEMICARBAZIDE serves as a chemical probe in biological studies, allowing researchers to explore its potential interactions with biological targets and understand its mechanism of action. This knowledge can contribute to the discovery of novel therapeutic agents and the advancement of drug development in various fields.
Used in Drug Delivery Systems:
In the field of drug delivery, 4-[3-(4-MORPHOLINO)PROPYL]-3-THIOSEMICARBAZIDE can be utilized as a component in the design of targeted drug delivery systems. Its unique structure and biological activities may enable the development of innovative carriers for therapeutic agents, improving their delivery, bioavailability, and therapeutic outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 32813-48-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,8,1 and 3 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 32813-48:
(7*3)+(6*2)+(5*8)+(4*1)+(3*3)+(2*4)+(1*8)=102
102 % 10 = 2
So 32813-48-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H18N4OS/c9-11-8(14)10-2-1-3-12-4-6-13-7-5-12/h1-7,9H2,(H2,10,11,14)
