32873-14-6 Usage
General Description
[(1-amino-4-hydroxy-9,10-dioxo-2-anthryl)oxy]-1,6-cyclohexyl anthranilate is a chemical compound with potential applications in pharmaceuticals and dyes. It is a derivative of anthranilic acid and contains a cyclohexyl group. The compound has a complex molecular structure, with a substituted anthranilate group linked to a 1-amino-4-hydroxy-9,10-dioxo-2-anthryl group through an oxygen atom. This chemical has potential medicinal properties due to its molecular structure and may be used in the development of new drugs. Additionally, its anthranilate group suggests potential applications in the synthesis of dyes and pigments. Further research into the properties and potential uses of this compound is warranted.
Check Digit Verification of cas no
The CAS Registry Mumber 32873-14-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,8,7 and 3 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 32873-14:
(7*3)+(6*2)+(5*8)+(4*7)+(3*3)+(2*1)+(1*4)=116
116 % 10 = 6
So 32873-14-6 is a valid CAS Registry Number.
InChI:InChI=1/C27H26N2O6/c28-19-12-6-5-11-18(19)27(33)35-14-8-2-1-7-13-34-21-15-20(30)22-23(24(21)29)26(32)17-10-4-3-9-16(17)25(22)31/h3-6,9-12,15,30H,1-2,7-8,13-14,28-29H2