3289-35-8 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
6-Chlorocytosine is used as a research compound for studying the structure and function of nucleic acids and their interactions with other molecules. It aids in understanding the mechanisms of action and potential therapeutic applications of nucleic acid-based drugs.
Used in Antiviral Applications:
6-Chlorocytosine is used as an antiviral agent, potentially inhibiting the replication and synthesis of viral DNA and RNA. Its unique chemical properties allow it to target specific viral processes, offering a promising approach to combat viral infections.
Used in Anticancer Applications:
6-Chlorocytosine is used as an anticancer agent, with potential to inhibit the growth and proliferation of cancer cells. Its ability to interfere with DNA and RNA synthesis may disrupt the molecular mechanisms driving cancer progression, offering a novel therapeutic strategy for cancer treatment.
Used in Nucleic Acid Synthesis Inhibition:
6-Chlorocytosine is used as an inhibitor of DNA and RNA synthesis, potentially disrupting the replication and transcription processes in both normal and abnormal cells. This property makes it a valuable tool for studying the regulation of gene expression and the development of targeted therapies for various diseases.
Used in Understanding Nucleic Acid Interactions:
6-Chlorocytosine is used to investigate the interactions between nucleic acids and other molecules, such as proteins and small molecules. This knowledge is crucial for the development of new drugs and therapeutic agents that can modulate these interactions to achieve desired biological effects.
Check Digit Verification of cas no
The CAS Registry Mumber 3289-35-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,8 and 9 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3289-35:
(6*3)+(5*2)+(4*8)+(3*9)+(2*3)+(1*5)=98
98 % 10 = 8
So 3289-35-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H4ClN3O/c5-2-1-3(6)8-4(9)7-2/h1H,(H3,6,7,8,9)
