32890-88-3 Usage
Uses
Used in Pharmaceutical Industry:
2,6-Difluoro-3-methylbenzoic acid is used as a key intermediate for the synthesis of various pharmaceuticals. Its unique structure and reactivity allow for the development of new drugs with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical industry, 2,6-Difluoro-3-methylbenzoic acid serves as a crucial building block for the synthesis of novel agrochemicals. Its incorporation into these compounds can enhance their pesticidal or herbicidal properties, leading to more effective crop protection.
Used in Organic Chemistry:
2,6-Difluoro-3-methylbenzoic acid is utilized as a versatile building block in organic chemistry for the preparation of various derivatives and intermediates. Its presence in these compounds can impart unique chemical and physical properties, facilitating the development of new materials and catalysts.
Used in Medicinal Chemistry and Drug Discovery:
2,6-Difluoro-3-methylbenzoic acid is employed as a valuable component in medicinal chemistry and drug discovery. Its ability to modify the biological activity of certain compounds makes it a promising candidate for the development of new therapeutic agents with improved pharmacological profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 32890-88-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,8,9 and 0 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 32890-88:
(7*3)+(6*2)+(5*8)+(4*9)+(3*0)+(2*8)+(1*8)=133
133 % 10 = 3
So 32890-88-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H6F2O2/c1-4-2-3-5(9)6(7(4)10)8(11)12/h2-3H,1H3,(H,11,12)
32890-88-3Relevant academic research and scientific papers
2-Fluoro-6-trifluoromethylbenzoic acid
-
, (2008/06/13)
2,6-halo and trifluoromethyl-substituted-benzoic acids, e.g., 2,3,4,6-tetrafluorobenzoic acid or 2-chloro-6-trifluoromethylbenzoic acid, are prepared from substituted 2,4-halo and trifluoromethyl-substituted benzene compounds and are useful as plant growt
