32890-89-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-6-fluoro-3-methylbenzoic acid is used as a key intermediate for the synthesis of biologically active compounds due to its anti-inflammatory, fungicidal, and bactericidal properties. It plays a crucial role in the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Chloro-6-fluoro-3-methylbenzoic acid is employed as a precursor in the production of herbicides. Its biological activities contribute to the development of effective weed control agents, enhancing agricultural productivity.
Used in Materials Science:
2-Chloro-6-fluoro-3-methylbenzoic acid is utilized as an intermediate in the production of organic pigments and dyes. Its unique chemical structure allows for the creation of colorants with specific properties, contributing to the advancement of materials science and the development of novel applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 32890-89-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,8,9 and 0 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 32890-89:
(7*3)+(6*2)+(5*8)+(4*9)+(3*0)+(2*8)+(1*9)=134
134 % 10 = 4
So 32890-89-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClFO2/c1-4-2-3-5(10)6(7(4)9)8(11)12/h2-3H,1H3,(H,11,12)
32890-89-4Relevant academic research and scientific papers
INHIBITORS OF STEAROYL-COA DESATURASE
-
, (2009/06/27)
Provided herein are compounds of the formula (I): as well as pharmaceutically acceptable salts thereof, wherein the substituents are as those disclosed in the specification. These compounds, and the pharmaceutical compositions containing them, are useful for the treatment of diseases such as, for example, obesity.
