32890-91-8 Usage
Uses
Used in Pharmaceutical Industry:
2,3-DICHLORO-6-FLUOROBENZOIC ACID serves as an intermediate in the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3-DICHLORO-6-FLUOROBENZOIC ACID is utilized as an intermediate for the production of pesticides and other agrochemicals. Its role in this industry is crucial for the development of effective solutions to protect crops and enhance agricultural productivity.
Used in Dye Production:
2,3-DICHLORO-6-FLUOROBENZOIC ACID also acts as a building block in the creation of dyes. Its chemical properties make it suitable for the synthesis of a range of dyes used in various applications, including textiles, plastics, and printing inks.
Used in Organic Compounds Synthesis:
Furthermore, 2,3-DICHLORO-6-FLUOROBENZOIC ACID is employed in the synthesis of other organic compounds. Its versatile structure allows it to be a valuable precursor in the production of specialty chemicals for a wide array of industries.
Check Digit Verification of cas no
The CAS Registry Mumber 32890-91-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,8,9 and 0 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 32890-91:
(7*3)+(6*2)+(5*8)+(4*9)+(3*0)+(2*9)+(1*1)=128
128 % 10 = 8
So 32890-91-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H3Cl2FO2/c8-3-1-2-4(10)5(6(3)9)7(11)12/h1-2H,(H,11,12)
