328925-71-9 Usage
Uses
Since the exact uses and applications of 1-(4-CHLOROPHENYL)-3-(5-ETHYL-2-HYDROXYPHENYL)PROPANE-1,3-DIONE are not specified in the provided materials, we can only speculate on its potential applications based on its structural features and the general properties of chalcones. Here are some possible applications:
Used in Pharmaceutical Industry:
1-(4-CHLOROPHENYL)-3-(5-ETHYL-2-HYDROXYPHENYL)PROPANE-1,3-DIONE could be used as a starting material or intermediate for the synthesis of various pharmaceutical compounds due to its complex structure and potential pharmacological properties.
Used in Chemical Research:
As a member of the chalcone class, 1-(4-CHLOROPHENYL)-3-(5-ETHYL-2-HYDROXYPHENYL)PROPANE-1,3-DIONE may be used in chemical research to study its reactivity, stability, and potential interactions with other molecules, which could lead to the development of new chemical processes or products.
Used in Material Science:
The unique structure of 1-(4-CHLOROPHENYL)-3-(5-ETHYL-2-HYDROXYPHENYL)PROPANE-1,3-DIONE may also make it a candidate for the development of new materials with specific properties, such as improved thermal stability or chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 328925-71-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,8,9,2 and 5 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 328925-71:
(8*3)+(7*2)+(6*8)+(5*9)+(4*2)+(3*5)+(2*7)+(1*1)=169
169 % 10 = 9
So 328925-71-9 is a valid CAS Registry Number.
InChI:InChI=1/C17H15ClO3/c1-2-11-3-8-15(19)14(9-11)17(21)10-16(20)12-4-6-13(18)7-5-12/h3-9,19H,2,10H2,1H3
