328925-71-9 Usage
General Description
1-(4-chlorophenyl)-3-(5-ethyl-2-hydroxyphenyl)propane-1,3-dione is a chemical compound with a complex structure that includes a 4-chlorophenyl group, a 5-ethyl-2-hydroxyphenyl group, and a propane-1,3-dione backbone. 1-(4-CHLOROPHENYL)-3-(5-ETHYL-2-HYDROXYPHENYL)PROPANE-1,3-DIONE belongs to the class of chalcones, which are a type of organic compounds known for their various biological activities. It is likely to have pharmacological properties due to the presence of the hydroxyphenyl group, and the chlorophenyl group may also confer specific chemical reactivity. The exact uses and applications of this compound are not specified, but its unique structure makes it a potential candidate for further study in the fields of chemistry and pharmacology.
Check Digit Verification of cas no
The CAS Registry Mumber 328925-71-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,8,9,2 and 5 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 328925-71:
(8*3)+(7*2)+(6*8)+(5*9)+(4*2)+(3*5)+(2*7)+(1*1)=169
169 % 10 = 9
So 328925-71-9 is a valid CAS Registry Number.
InChI:InChI=1/C17H15ClO3/c1-2-11-3-8-15(19)14(9-11)17(21)10-16(20)12-4-6-13(18)7-5-12/h3-9,19H,2,10H2,1H3
