32936-74-6 Usage
Uses
Used in Organic Synthesis:
3-cyclobutene-1,2-dione is utilized as a key reagent in organic synthesis for its ability to participate in a variety of chemical reactions. Its involvement in Diels-Alder cycloadditions, ene reactions, and nucleophilic additions makes it a valuable component in creating complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-cyclobutene-1,2-dione is employed as a building block for the synthesis of pharmaceutical compounds. Its reactivity and capacity to form stable intermediates in various chemical reactions contribute to the development of new drug molecules.
Used in Chemical Research:
3-cyclobutene-1,2-dione serves as a crucial intermediate in chemical research, particularly in the study of reaction mechanisms and the development of new synthetic methodologies. Its unique properties and reactivity provide researchers with opportunities to explore novel pathways and enhance existing synthetic processes.
Used in Material Science:
In material science, 3-cyclobutene-1,2-dione is used as a precursor in the synthesis of advanced materials with specific properties. Its role in creating complex molecular structures is vital for developing materials with tailored characteristics for various applications.
Used in Specialty Chemicals Production:
3-cyclobutene-1,2-dione is also used in the production of specialty chemicals, where its reactivity and instability are harnessed to create unique chemical entities that find use in niche applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 32936-74-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,9,3 and 6 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 32936-74:
(7*3)+(6*2)+(5*9)+(4*3)+(3*6)+(2*7)+(1*4)=126
126 % 10 = 6
So 32936-74-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H2O2/c5-3-1-2-4(3)6/h1-2H
32936-74-6Relevant academic research and scientific papers
CYCLOBUTENDION UND METHYLENCYCLOBUTENON. SYNTHESE, DIENOPHILE REAKTIVITAET UND EXO, ENDO-SELECTIVITAET
Martin, Hans-Dieter,Oftring, Alfred,Iden, Ruediger,Schwichtenberg, Evelyn,Schiwek, Hans-Joachim
, p. 841 - 844 (2007/10/02)
A new synthesis of cyclobutenedione and methylenecyclobutenone and their reactions with 1,3-dienes are described.
