32997-86-7 Usage
Uses
Used in Organic Synthesis:
2-Chloroacrylic acid sodium salt is used as a reagent in organic synthesis for its ability to facilitate various chemical reactions and the formation of new compounds.
Used in Polymerization:
2-Chloroacrylic acid sodium salt is used as a polymerization initiator, playing a crucial role in the process of forming polymers from monomers.
Used in Pharmaceutical Production:
2-Chloroacrylic acid sodium salt is used as a precursor in the production of pharmaceuticals, contributing to the synthesis of various medicinal compounds.
Used in Agrochemical Production:
2-Chloroacrylic acid sodium salt is used in the production of agrochemicals, serving as a starting material for the synthesis of various agricultural chemicals.
Used in Specialty Chemicals Production:
2-Chloroacrylic acid sodium salt is used in the production of specialty chemicals, where its unique properties are leveraged for specific applications in various industries.
It is important to handle 2-Chloroacrylic acid sodium salt with care, as it is a corrosive substance and can cause irritation to the skin, eyes, and respiratory system.
Check Digit Verification of cas no
The CAS Registry Mumber 32997-86-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,9,9 and 7 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 32997-86:
(7*3)+(6*2)+(5*9)+(4*9)+(3*7)+(2*8)+(1*6)=157
157 % 10 = 7
So 32997-86-7 is a valid CAS Registry Number.
InChI:InChI=1/C3H3ClO2.Na/c1-2(4)3(5)6;/h1H2,(H,5,6);/q;+1/p-1
