32998-28-0 Usage
Uses
Used in Pharmaceutical Industry:
1,3,4-Thiadiazole, 2,5-dichlorois used as a building block for the synthesis of various pharmaceuticals due to its unique chemical structure and properties. It contributes to the development of new drugs with potential antimicrobial and antifungal activities, addressing the growing need for effective treatments against resistant pathogens.
Used in Agrochemical Industry:
In the agrochemical industry, 1,3,4-Thiadiazole, 2,5-dichlorois employed as a key component in the creation of crop protection products. Its antimicrobial and antifungal properties make it a valuable asset in developing innovative solutions to protect crops from diseases and pests, ensuring sustainable agricultural practices.
Used in Materials Science:
1,3,4-Thiadiazole, 2,5-dichlorohas potential applications in materials science, where its unique chemical properties can be harnessed to develop new materials with specific characteristics. These materials can be used in various industries, such as electronics, coatings, and adhesives, to enhance performance and durability.
Used as a Starting Material for Synthesis of Functionalized Derivatives:
1,3,4-Thiadiazole, 2,5-dichloroserves as a starting material for the synthesis of various functionalized derivatives with diverse chemical properties. These derivatives can be further utilized in different applications, such as in the development of new drugs, agrochemicals, or materials with specific functionalities, expanding the compound's potential uses across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 32998-28-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,9,9 and 8 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 32998-28:
(7*3)+(6*2)+(5*9)+(4*9)+(3*8)+(2*2)+(1*8)=150
150 % 10 = 0
So 32998-28-0 is a valid CAS Registry Number.
InChI:InChI=1/C2Cl2N2S/c3-1-5-6-2(4)7-1
32998-28-0Relevant academic research and scientific papers
Pati, Anita,Patra, Manabendra,Behera, Rajani K.
, p. 1801 - 1808 (2006)
The syntheses of 1:1-macrocycles 3 (n = 1), unsymmetrical macrocycle 5 (m = 0, n = 1), 2:2-macrocycle 5 (m = n = 1 and 2), 3:3 macrocycle 7, and several open-chain ethereal compounds prepared from 2,5-dichloro-1,3,4-thiadiazole 1 and various polyethylene glycols dianions are described. Structural proofs are afforded by their mass and NMR spectral features. The quaternization studies of a few macrocycles with methyl iodide at elevated temperature furnished a diketo derivative 8 through a facile Hilbert-Johnson reaction. Copyright Taylor & Francis Group, LLC.
