330-48-3 Usage
Uses
Used in Pharmaceutical Synthesis:
N-(3,4-difluorophenyl)-3,4-difluoro-aniline serves as a key building block in the development of pharmaceuticals. Its unique structure allows for the creation of new drug candidates with potential therapeutic benefits.
Used in Agrochemical Production:
In the agrochemical industry, N-(3,4-difluorophenyl)-3,4-difluoro-aniline is utilized in the synthesis of various compounds that contribute to crop protection and enhancement of agricultural yields.
Used in Dye Manufacturing:
N-(3,4-difluorophenyl)-3,4-difluoro-aniline is also employed in the production of dyes, where its distinctive properties can be harnessed to create dyes with specific color characteristics and stability.
Used in Organic Synthesis:
N-(3,4-difluorophenyl)-3,4-difluoro-aniline is a valuable reagent in organic synthesis, facilitating a range of chemical reactions that can lead to the formation of diverse organic compounds.
Used in Materials Science:
Its potential applications extend to materials science, where it may contribute to the development of new materials with unique properties.
Used as a Precursor in Synthetic Methods:
Furthermore, N-(3,4-difluorophenyl)-3,4-difluoro-aniline acts as a precursor in the development of innovative synthetic methods, expanding the scope of chemical synthesis.
Safety Note:
Given its toxic and potentially hazardous nature, it is crucial to exercise proper care in handling and storing N-(3,4-difluorophenyl)-3,4-difluoro-aniline to ensure safety and prevent adverse effects.
Check Digit Verification of cas no
The CAS Registry Mumber 330-48-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,3 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 330-48:
(5*3)+(4*3)+(3*0)+(2*4)+(1*8)=43
43 % 10 = 3
So 330-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H7F4N/c13-9-3-1-7(5-11(9)15)17-8-2-4-10(14)12(16)6-8/h1-6,17H
