330-48-3 Usage
General Description
N-(3,4-difluorophenyl)-3,4-difluoro-aniline is a chemical compound with the molecular formula C6H4F4N. It is a substituted aniline derivative with two fluorine atoms attached to both the phenyl ring and the amino group. N-(3,4-difluorophenyl)-3,4-difluoro-aniline is commonly used in the synthesis of pharmaceuticals, agrochemicals, and dyes. Its unique structure and properties make it a valuable building block in organic synthesis, and it is also used as a reagent in various chemical reactions. Additionally, N-(3,4-difluorophenyl)-3,4-difluoro-aniline has potential applications in materials science and as a precursor in the development of new synthetic methods. However, due to its toxic and potentially hazardous nature, proper precautions should be taken when handling and storing this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 330-48-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,3 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 330-48:
(5*3)+(4*3)+(3*0)+(2*4)+(1*8)=43
43 % 10 = 3
So 330-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H7F4N/c13-9-3-1-7(5-11(9)15)17-8-2-4-10(14)12(16)6-8/h1-6,17H
