33024-46-3 Usage
Chemical class
Urea derivative
1-(2-Fluoroethyl)-1-nitroso-3-(3,4-dihydro-2H-1-benzothiopyran-4-yl)urea belongs to a class of organic compounds that contain a urea functional group.
Nitroso group
Contains a nitrogen-oxygen double bond (N=O)
The presence of a nitroso group gives the compound unique chemical and biological properties.
Fluorine atom
Attached to an ethyl group
The fluorine atom substitution can significantly affect the compound's reactivity, stability, and biological activity.
Benzothiopyran-4-yl group
A heterocyclic aromatic ring system
Pharmaceutical research potential
Unique structure and potential biological activity
The compound's structure and properties make it a candidate for further investigation in the development of new drugs.
Further studies required
To fully understand properties and potential applications
More research is needed to determine the compound's specific properties, such as solubility, stability, and pharmacological effects.
Molecular weight
Approximately 256.28 g/mol
The molecular weight is an important parameter for understanding the compound's physical and chemical properties.
Structural isomers
Potential for different arrangements of atoms
The compound may have structural isomers, which are compounds with the same molecular formula but different arrangements of atoms.
Reactivity
Influenced by the presence of the nitroso group, fluorine atom, and benzothiopyran-4-yl group
The reactivity of the compound can be affected by the specific functional groups and their interactions with other molecules.
Biological activity
Potential for interaction with biological targets
The compound's unique structure may allow it to interact with specific biological targets, which could be useful in the development of new pharmaceuticals.
Safety and toxicity
Unknown at this time
Further research is needed to determine the safety and potential toxic effects of the compound on humans and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 33024-46-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,0,2 and 4 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 33024-46:
(7*3)+(6*3)+(5*0)+(4*2)+(3*4)+(2*4)+(1*6)=73
73 % 10 = 3
So 33024-46-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H14FN3O2S/c13-6-7-16(15-18)12(17)14-10-5-8-19-11-4-2-1-3-9(10)11/h1-4,10H,5-8H2,(H,14,17)
