33024-77-0 Usage
Uses
Used in Agricultural Industry:
1-(2-chloroethoxy)-3-phenyl-urea is used as a herbicide and pesticide for controlling the growth of various weeds and pests. Its application reason is based on its ability to interfere with the plant or pest's ability to produce essential proteins, ultimately leading to their death.
Used in Pharmaceutical Industry:
1-(2-chloroethoxy)-3-phenyl-urea is used as a potential therapeutic agent for the treatment of cancer and other diseases. The application reason is its capacity to disrupt the production of essential proteins in cancer cells, thereby inhibiting their growth and proliferation. Further research and development are necessary to fully understand its potential and optimize its use in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 33024-77-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,0,2 and 4 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 33024-77:
(7*3)+(6*3)+(5*0)+(4*2)+(3*4)+(2*7)+(1*7)=80
80 % 10 = 0
So 33024-77-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H11ClN2O2/c10-6-7-14-12-9(13)11-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,11,12,13)
