330433-43-7 Usage
Uses
Used in Pharmaceutical Industry:
6-chloro-N4-methylpyrimidine-2,4,5-triamine is used as a key intermediate in the synthesis of various pharmaceuticals for its potential biological activities. Its unique structure allows for the development of compounds with anti-cancer and anti-microbial properties, contributing to the creation of new treatments and therapies.
Used in Agrochemical Industry:
In the agrochemical sector, 6-chloro-N4-methylpyrimidine-2,4,5-triamine is utilized as a building block in the development of pesticides and other agrochemical products. Its chemical properties make it suitable for creating compounds that can effectively target and control pests, thereby enhancing crop protection and yield.
Used in Organic Compounds Synthesis:
6-chloro-N4-methylpyrimidine-2,4,5-triamine is employed as a versatile intermediate in the synthesis of a wide range of organic compounds. Its ability to form various chemical bonds and its unique structure make it a valuable component in organic chemistry for creating diverse molecules with different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 330433-43-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,0,4,3 and 3 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 330433-43:
(8*3)+(7*3)+(6*0)+(5*4)+(4*3)+(3*3)+(2*4)+(1*3)=97
97 % 10 = 7
So 330433-43-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H8ClN5/c1-9-4-2(7)3(6)10-5(8)11-4/h7H2,1H3,(H3,8,9,10,11)
