33073-01-7 Usage
General Description
1,9-DIMETHYLXANTHINE, also known as caffeine, is a naturally occurring chemical compound found in coffee, tea, and other beverages. It is a central nervous system stimulant and is widely consumed for its stimulating effects on alertness and energy levels. It works by blocking the action of adenosine, a neurotransmitter that promotes relaxation and sleepiness. This leads to increased neural activity and the release of other neurotransmitters, such as dopamine and norepinephrine, which contribute to its stimulating effects. Additionally, caffeine has been shown to have potential health benefits, such as improving mental alertness, enhancing physical performance, and reducing the risk of certain diseases, when consumed in moderate amounts. However, excessive consumption of caffeine can lead to negative side effects, such as insomnia, anxiety, and increased heart rate.
Check Digit Verification of cas no
The CAS Registry Mumber 33073-01-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,0,7 and 3 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 33073-01:
(7*3)+(6*3)+(5*0)+(4*7)+(3*3)+(2*0)+(1*1)=77
77 % 10 = 7
So 33073-01-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4O2/c1-10-3-8-4-5(10)9-7(13)11(2)6(4)12/h3H,1-2H3,(H,9,13)
