3313-48-2 Usage
Uses
Used in Pharmaceutical Industry:
H-GLY-GLY-BETANA HBR is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a valuable building block for the development of new drugs with specific therapeutic properties.
Used in Chemical Research:
In the field of chemical research, H-GLY-GLY-BETANA HBR serves as a key compound for studying the properties and behavior of organic molecules. It can be used to investigate various chemical reactions and mechanisms, contributing to the advancement of scientific knowledge in organic chemistry.
Used in Organic Synthesis:
H-GLY-GLY-BETANA HBR is used as a reagent in organic synthesis for the production of various organic compounds. Its versatile structure makes it a valuable tool for creating a wide range of molecules with different functional groups and properties.
Used in Material Science:
In the field of material science, H-GLY-GLY-BETANA HBR can be utilized in the development of novel materials with specific properties. Its unique molecular structure can be exploited to create materials with enhanced mechanical, electrical, or optical characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 3313-48-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,1 and 3 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3313-48:
(6*3)+(5*3)+(4*1)+(3*3)+(2*4)+(1*8)=62
62 % 10 = 2
So 3313-48-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H15N3O2.BrH/c15-8-13(18)16-9-14(19)17-12-6-5-10-3-1-2-4-11(10)7-12;/h1-7H,8-9,15H2,(H,16,18)(H,17,19);1H