33136-66-2 Usage
Uses
Used in Asymmetric Catalysis:
(S)-1-Ferrocenylethanol is used as a chiral ligand for enhancing the selectivity of chemical reactions in asymmetric catalysis. Its unique structure allows it to influence the stereochemistry of reactions, leading to the preferential formation of one enantiomer over another.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, (S)-1-Ferrocenylethanol is used as a key intermediate in the synthesis of various organic compounds and pharmaceuticals. Its ability to affect the stereochemistry of reactions is crucial for the production of enantiomerically pure drugs, which is essential for their therapeutic efficacy and safety.
Used in Material Science:
(S)-1-Ferrocenylethanol has potential applications in the development of new materials. Its redox properties and ability to interact with other molecules make it a promising candidate for the construction of complex molecules with specific properties, such as sensors, catalysts, and functional materials.
Used in Organic Synthesis:
As a versatile building block, (S)-1-Ferrocenylethanol is used in organic synthesis for the construction of complex organic molecules. Its unique properties allow for the creation of molecules with specific functions and applications in various fields, including medicine, agriculture, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 33136-66-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,1,3 and 6 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 33136-66:
(7*3)+(6*3)+(5*1)+(4*3)+(3*6)+(2*6)+(1*6)=92
92 % 10 = 2
So 33136-66-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O.C5H4.Fe/c1-6(8)7-4-2-3-5-7;1-2-4-5-3-1;/h2-4,6,8H,1H3;1-4H;/q2*-1;+2/t6-;;/m0../s1/rC12H12FeO/c1-9(14)11-7-4-8-12(11)13-10-5-2-3-6-10/h2-9,14H,1H3/t9-/m0/s1
