33144-86-4 Usage
Family
1,2,4-triazole
Contains
Selenoxo group (a selenium atom double-bonded to an oxygen atom)
Type of compound
Heterocyclic organic compound
Potential applications
Medicinal chemistry
Unique structure
Contributes to its potential medicinal and biological applications
Biological activities
Investigated and show promising results in some studies
Toxicity
Investigated in relation to its potential applications
Interest
Both chemistry and biology fields due to its potential medicinal and biological applications
Check Digit Verification of cas no
The CAS Registry Mumber 33144-86-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,1,4 and 4 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 33144-86:
(7*3)+(6*3)+(5*1)+(4*4)+(3*4)+(2*8)+(1*6)=94
94 % 10 = 4
So 33144-86-4 is a valid CAS Registry Number.
InChI:InChI=1/C3H5N3Se/c1-2-4-3(7)6-5-2/h1H3,(H2,4,5,6,7)
