331766-69-9 Usage
Uses
Used in Pharmaceutical Industry:
N-Methyl-(2-bromothien-3-yl)methylamine is utilized as a key intermediate or building block in the synthesis of a wide range of pharmaceuticals and organic compounds. Its unique structure and properties contribute to the development of new drugs and chemical products, enhancing their therapeutic potential and applications in various medical fields.
Used in Drug Synthesis:
N-Methyl-(2-bromothien-3-yl)methylamine is employed as a crucial component in the synthesis of various drugs, particularly those targeting specific diseases and conditions. Its presence in the molecular structure of these drugs allows for the modulation of their pharmacological properties, improving their efficacy, selectivity, and safety profiles.
Used in Chemical Product Development:
Beyond its applications in the pharmaceutical industry, N-Methyl-(2-bromothien-3-yl)methylamine is also used in the development of other chemical products. Its unique structure and properties make it a valuable building block for the creation of novel compounds with diverse applications in various industries, such as agriculture, materials science, and environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 331766-69-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,1,7,6 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 331766-69:
(8*3)+(7*3)+(6*1)+(5*7)+(4*6)+(3*6)+(2*6)+(1*9)=149
149 % 10 = 9
So 331766-69-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H8BrNS/c1-8-4-5-2-3-9-6(5)7/h2-3,8H,4H2,1H3
