332-91-2 Usage
Type of compound
Ketone
Fluorine atoms
Two fluorine atoms attached to the carbon chain
Usage
Often used in organic synthesis and medicinal chemistry
Role
Building block for creating more complex molecules
Unique properties
Presence of fluorine atoms can impart unique properties to the compound
Applications
Useful in various research and industrial applications
Specific chemical and physical properties
Valuable tool in the development of new pharmaceuticals and materials
Check Digit Verification of cas no
The CAS Registry Mumber 332-91-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,3 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 332-91:
(5*3)+(4*3)+(3*2)+(2*9)+(1*1)=52
52 % 10 = 2
So 332-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H24F2O/c14-11-7-3-1-2-5-9-13(16)10-6-4-8-12-15/h1-12H2
