332064-87-6 Usage
Uses
Used in Organic Synthesis:
(R)-3-Amino-5-hexynoic acid hydrochloride is used as a building block in organic synthesis for the creation of various pharmaceuticals and biologically active compounds. Its unique structure allows for the development of new molecules with potential therapeutic applications.
Used in Pharmaceutical Research:
In pharmaceutical research, (R)-3-Amino-5-hexynoic acid hydrochloride serves as a key component in the synthesis of new drugs. Its hydrochloride form enhances its stability and water solubility, which can be advantageous for drug formulation and delivery.
Used in Drug Development:
(R)-3-Amino-5-hexynoic acid hydrochloride is utilized in the development of new drugs due to its potential to contribute to the creation of novel therapeutic agents. Its unique chemical properties may offer new avenues for treating various diseases and conditions.
Used in Material Science:
Although not explicitly mentioned in the provided materials, given its unique chemical structure, (R)-3-Amino-5-hexynoic acid hydrochloride may also find applications in material science, potentially contributing to the development of new materials with specific properties for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 332064-87-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,2,0,6 and 4 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 332064-87:
(8*3)+(7*3)+(6*2)+(5*0)+(4*6)+(3*4)+(2*8)+(1*7)=116
116 % 10 = 6
So 332064-87-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H9NO2.ClH/c1-2-3-5(7)4-6(8)9;/h1,5H,3-4,7H2,(H,8,9);1H/t5-;/m1./s1
