33240-56-1 Usage
Uses
Used in Chemical Synthesis:
1-Chloro-5-methylhexane is used as a solvent and an intermediate in chemical synthesis for various applications, including the production of pharmaceuticals and agrochemicals. Its unique properties make it a valuable component in the synthesis of a wide range of compounds.
Used in Pharmaceutical Production:
In the pharmaceutical industry, 1-chloro-5-methylhexane is utilized as an intermediate in the synthesis of specific drugs. Its role in the production process is crucial for creating the desired medicinal compounds.
Used in Agrochemical Production:
Similarly, in the agrochemical sector, 1-chloro-5-methylhexane serves as an intermediate in the synthesis of various agrochemicals, contributing to the development of products used in agriculture to protect crops and enhance yields.
Safety Precautions:
Check Digit Verification of cas no
The CAS Registry Mumber 33240-56-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,2,4 and 0 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 33240-56:
(7*3)+(6*3)+(5*2)+(4*4)+(3*0)+(2*5)+(1*6)=81
81 % 10 = 1
So 33240-56-1 is a valid CAS Registry Number.
InChI:InChI=1S/C7H15Cl/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3
