3326-09-8 Usage
Uses
Used in Organic Synthesis:
S-(2,2-Dichlorovinyl)-L-Cysteine is used as a synthetic building block for the development of various organic compounds. Its unique structure, which includes a dichlorovinyl group and a cysteine residue, makes it a valuable intermediate in the synthesis of complex organic molecules, particularly those with potential applications in pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, S-(2,2-Dichlorovinyl)-L-Cysteine is used as a key intermediate in the synthesis of therapeutic agents. Its unique chemical properties allow for the development of novel drugs with specific targeting capabilities, potentially leading to more effective treatments for various diseases and conditions.
Used in Agrochemical Industry:
S-(2,2-Dichlorovinyl)-L-Cysteine is also utilized in the agrochemical industry for the synthesis of new pesticides and other crop protection agents. Its unique structure can be exploited to create compounds with enhanced biological activity and selectivity, contributing to the development of more effective and environmentally friendly agrochemicals.
Used in Research and Development:
In addition to its applications in organic synthesis and various industries, S-(2,2-Dichlorovinyl)-L-Cysteine is also used as a research tool in academic and industrial laboratories. Its unique properties make it an interesting compound for studying various chemical reactions and exploring new synthetic routes, ultimately contributing to the advancement of scientific knowledge in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 3326-09-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,2 and 6 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 3326-09:
(6*3)+(5*3)+(4*2)+(3*6)+(2*0)+(1*9)=68
68 % 10 = 8
So 3326-09-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H7Cl2NO2S/c6-4(7)2-11-1-3(8)5(9)10/h2-3H,1,8H2,(H,9,10)/t3-/m0/s1
