33265-61-1 Usage
Uses
Used in Chemical Synthesis:
1-(2-Nitrophenyl)-1H-pyrrole-2-carbaldehyde is used as a key intermediate in the synthesis of various organic compounds. Its reactivity, due to the presence of the aldehyde group, allows it to participate in a wide range of chemical reactions, such as condensation, reduction, and oxidation, leading to the formation of diverse chemical products.
Used in Pharmaceutical Industry:
1-(2-Nitrophenyl)-1H-pyrrole-2-carbaldehyde is used as a building block in the development of new pharmaceutical compounds. Its unique structure and reactivity enable the creation of novel drug candidates with potential therapeutic applications, such as antimicrobial, anticancer, or antiviral properties.
Used in Material Science:
1-(2-Nitrophenyl)-1H-pyrrole-2-carbaldehyde is used as a component in the synthesis of advanced materials, such as polymers, dyes, and sensors. Its incorporation into these materials can impart specific properties, such as improved stability, enhanced reactivity, or altered electronic characteristics, which can be beneficial in various applications.
Used in Analytical Chemistry:
1-(2-Nitrophenyl)-1H-pyrrole-2-carbaldehyde is used as a reagent in analytical chemistry for the detection and quantification of various analytes. Its reactivity with specific compounds can be exploited to develop sensitive and selective analytical methods, such as spectrophotometry or electrochemistry, for the analysis of complex samples.
Check Digit Verification of cas no
The CAS Registry Mumber 33265-61-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,2,6 and 5 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 33265-61:
(7*3)+(6*3)+(5*2)+(4*6)+(3*5)+(2*6)+(1*1)=101
101 % 10 = 1
So 33265-61-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2O3/c14-8-9-4-3-7-12(9)10-5-1-2-6-11(10)13(15)16/h1-8H
33265-61-1Relevant academic research and scientific papers
Expeditious synthesis of imidazole-and pyrrole-fused benzodiazocines
Mishra, Amita,Batra, Sanjay
experimental part, p. 4832 - 4840 (2010/10/21)
A straightforward strategy for the synthesis of imidazolefused benzodiazocine from 1-(2-nitrophenyl)-1H-imidazole2-carbaldehyde via Morita-Baylls-Hillman reaction followed by reductive intramolecular cyclization is described. Alternatively the Horner-Wads
PHENYL PYRROLE AMINOGUANIDINE DERIVATIVES
-
Page/Page column 37, (2008/06/13)
The present invention relates to phenyl pyrrole aminoguanidine derivatives of the general formula (I): (I) including tautomeric forms thereof, wherein n is 1, 2 or 3; or a pharmaceutically acceptable salt thereof. The present invention further relates to
Structure-activity study of novel tricyclic benzazepine arginine vasopressin antagonists
Sum, Fuk-Wah,Dusza, John,Delos Santos, Efren,Grosu, George,Reich, Marvin,Du, Xumei,Albright, J. Donald,Chan, Peter,Coupet, Joseph,Ru, Xun,Mazandarani, Hossein,Saunders, Trina
, p. 2195 - 2198 (2007/10/03)
Novel tricyclic benzazepine derivatives were synthesized as arginine vasopressin (AVP) antagonists. Several tricyclic compounds showed potent antagonistic activity in rat AVP receptors V1a and V2. Derivatives containing pyrrolo-tricy
Tricyclic diazepine vasopressin antagonists and oxytocin antagonists
-
, (2008/06/13)
Tricyclic diazepines of the formula: STR1 wherein A, B, D, E, F, Y and Z are defined in the specification which compounds have vasopressin and oxytocin antagonist activity.