33289-51-9 Usage
Uses
Used in Pharmaceutical Research and Development:
6-Chloro-2-thien-2-ylquinoline-4-carboxylic acid is used as a chemical scaffold for the development of new pharmaceuticals due to its potential biological activity and structural features that can be modified for various therapeutic applications.
Used in Antitumor Applications:
In the field of oncology, 6-Chloro-2-thien-2-ylquinoline-4-carboxylic acid is used as a potential antitumor agent. It has been studied for its ability to target and inhibit the growth of cancer cells, making it a candidate for further research into cancer treatment.
Used in Antimicrobial Applications:
6-Chloro-2-thien-2-ylquinoline-4-carboxylic acid is also used as a potential antimicrobial agent. Its ability to combat microbial infections positions it as a candidate for the development of new antibiotics or antifungal agents, particularly in the context of increasing antibiotic resistance.
Used in Medicinal Chemistry:
In the realm of medicinal chemistry, 6-Chloro-2-thien-2-ylquinoline-4-carboxylic acid serves as a subject for synthesis and characterization studies. Its unique structure and properties make it an interesting compound for exploring new chemical reactions and potential drug candidates.
Used in Chemical Biology:
6-Chloro-2-thien-2-ylquinoline-4-carboxylic acid is utilized in chemical biology to understand its interactions with biological systems. This knowledge can contribute to the discovery of new biological targets and the development of targeted therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 33289-51-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,2,8 and 9 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 33289-51:
(7*3)+(6*3)+(5*2)+(4*8)+(3*9)+(2*5)+(1*1)=119
119 % 10 = 9
So 33289-51-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H8ClNO2S/c15-8-3-4-11-9(6-8)10(14(17)18)7-12(16-11)13-2-1-5-19-13/h1-7H,(H,17,18)
33289-51-9Relevant academic research and scientific papers
Synthesis and pharmacological properties of some quinoline derivatives
Kalluraya, Balakrishna,Sreenivasa
, p. 399 - 404 (2007/10/03)
A series of 2-(2-thienyl)cinchoninic acids 3, their derivatives 5 and 4-(3-substituted-1,2,4-triazolo[3,4-b]- 1,3,4-thiaziazolo-6-yl)-2-(2-thienyl)quinolines 6 were synthesized. The structures of the newly synthesized compounds are confirmed by analytical, IR, NMR and mass spectral data. The newly synthesized compounds were evaluated for their anti-inflammatory, analgesic and anthelmintic activity. The results indicated that dinitrothiophene derivatives 5 are more active.
