3329-14-4 Usage
Uses
Used in Pharmaceutical and Chemical Manufacturing:
1-(3,3-diphenylpropyl)piperidinium chloride is used as a phase-transfer catalyst for facilitating various reactions, such as nucleophilic substitution and alkylation reactions, in the pharmaceutical and chemical manufacturing industries. Its ability to transfer ions and molecules between immiscible phases makes it a key reagent in these processes.
Used in Organic Synthesis:
In the field of organic synthesis, 1-(3,3-diphenylpropyl)piperidinium chloride is used as a catalyst to enhance the efficiency and selectivity of various chemical reactions. Its unique structure allows it to act as a bridge between different reaction phases, improving the overall yield and quality of the synthesized products.
Used in Laboratory Applications:
1-(3,3-diphenylpropyl)piperidinium chloride is also utilized in laboratory settings for research and development purposes. Its catalytic properties make it a valuable tool for chemists working on new reactions and exploring the potential of different chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 3329-14-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,2 and 9 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3329-14:
(6*3)+(5*3)+(4*2)+(3*9)+(2*1)+(1*4)=74
74 % 10 = 4
So 3329-14-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H25N.ClH/c1-4-10-18(11-5-1)20(19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21;/h1-2,4-7,10-13,20H,3,8-9,14-17H2;1H
