33305-08-7 Usage
Description
METHYL THIAZOLIDINE-2-CARBOXYLATE HYDROCHLORIDE, also known as Thiazolidine-2-carboxylic acid methyl ester hydrochloride, is a cyclic secondary amino acid derivative. It features a thiazolidine-2-carboxylic acid (Thz) moiety that can exhibit ACE (angiotensin converting enzyme) inhibitor activity in vivo, making it a potential candidate for pharmaceutical applications.
Uses
Used in Pharmaceutical Industry:
METHYL THIAZOLIDINE-2-CARBOXYLATE HYDROCHLORIDE is used as a pharmaceutical compound for its ACE inhibitor activity. METHYL THIAZOLIDINE-2-CARBOXYLATE HYDROCHLORIDE can potentially be utilized in the development of drugs targeting conditions related to the renin-angiotensin system, such as hypertension and heart failure, due to its ability to inhibit the angiotensin converting enzyme.
Used in Drug Design and Synthesis:
In the field of drug design and synthesis, METHYL THIAZOLIDINE-2-CARBOXYLATE HYDROCHLORIDE serves as a valuable building block or intermediate for the creation of novel therapeutic agents. Its unique chemical structure allows for the development of new compounds with potential applications in various medical conditions, including but not limited to cardiovascular diseases.
Used in Research and Development:
METHYL THIAZOLIDINE-2-CARBOXYLATE HYDROCHLORIDE is also used as a research tool in the study of the renin-angiotensin system and its role in various physiological and pathological processes. METHYL THIAZOLIDINE-2-CARBOXYLATE HYDROCHLORIDE can help researchers better understand the mechanisms underlying the development of diseases and aid in the discovery of new therapeutic targets and strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 33305-08-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,3,0 and 5 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 33305-08:
(7*3)+(6*3)+(5*3)+(4*0)+(3*5)+(2*0)+(1*8)=77
77 % 10 = 7
So 33305-08-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NO2S.ClH/c1-8-5(7)4-6-2-3-9-4;/h4,6H,2-3H2,1H3;1H
