33311-76-1 Usage
General Description
N-(2-Benzoyl-4-nitrophenyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide is a chemical compound with the molecular formula C21H15N3O6. It belongs to the class of isoindole derivatives and is often used as a reagent in organic chemistry. N-(2-Benzoyl-4-nitrophenyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide has potential applications in pharmaceutical research due to its structural properties and functional groups. It is also known for its role as a ligand in coordination chemistry and has been studied for its potential biological activity. Furthermore, N-(2-Benzoyl-4-nitrophenyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide may have potential applications in the synthesis of other complex organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 33311-76-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,3,1 and 1 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 33311-76:
(7*3)+(6*3)+(5*3)+(4*1)+(3*1)+(2*7)+(1*6)=81
81 % 10 = 1
So 33311-76-1 is a valid CAS Registry Number.
InChI:InChI=1/C23H15N3O6/c27-20(13-25-22(29)16-8-4-5-9-17(16)23(25)30)24-19-11-10-15(26(31)32)12-18(19)21(28)14-6-2-1-3-7-14/h1-12H,13H2,(H,24,27)