33368-94-4 Usage
Uses
Used in Pharmaceutical Industry:
4-Imidazolidinone,5-methyl-2-thioxo-(9CI) is used as a pharmaceutical intermediate for the synthesis of various drugs. Its ability to form hydrogen bonds and its potential applications in drug design and development make it a valuable component in the creation of new medications.
Used in Organic Synthesis:
In the field of organic synthesis, 4-Imidazolidinone,5-methyl-2-thioxo-(9CI) serves as a building block for the development of complex organic compounds. Its unique structure and properties allow it to be incorporated into a wide range of chemical reactions, contributing to the synthesis of various organic molecules.
Used in Medicinal Chemistry:
4-Imidazolidinone,5-methyl-2-thioxo-(9CI) is used in medicinal chemistry due to its antimicrobial and antioxidant properties. These characteristics make it a potential candidate for the development of new drugs and therapies targeting various diseases and conditions.
Used in Antimicrobial Applications:
The antimicrobial properties of 4-Imidazolidinone,5-methyl-2-thioxo-(9CI) make it a valuable compound for use in the development of antimicrobial agents. It can be employed in the creation of new antibiotics or other antimicrobial drugs to combat bacterial infections.
Used in Antioxidant Applications:
The antioxidant properties of 4-Imidazolidinone,5-methyl-2-thioxo-(9CI) allow it to be used in the development of antioxidants for various applications. These antioxidants can be used in the pharmaceutical industry to protect against oxidative stress and related diseases, as well as in other industries such as cosmetics and food preservation.
Check Digit Verification of cas no
The CAS Registry Mumber 33368-94-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,3,6 and 8 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 33368-94:
(7*3)+(6*3)+(5*3)+(4*6)+(3*8)+(2*9)+(1*4)=124
124 % 10 = 4
So 33368-94-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N2OS/c1-2-3(7)6-4(8)5-2/h2H,1H3,(H2,5,6,7,8)
