33389-33-2 Usage
Uses
Used in Pharmaceutical Research:
1,2-Dihydro-2-(5-nitro-2-thienyl)quinazoline-4-one is used as a chemical compound in pharmaceutical research for its potential biological activity. 1,2-DIHYDRO-2-(5-NITRO-2-THIENYL)QUINAZOLINE-4-ONE's unique structure and properties make it a candidate for the development of new drugs to treat various medical conditions.
Used in Drug Development:
In the Drug Development industry, 1,2-Dihydro-2-(5-nitro-2-thienyl)quinazoline-4-one is used as a starting material or intermediate in the synthesis of novel therapeutic agents. Its chemical properties and potential interactions with biological targets may contribute to the creation of innovative medications with improved efficacy and safety profiles.
Used in Medicinal Chemistry:
1,2-Dihydro-2-(5-nitro-2-thienyl)quinazoline-4-one is utilized in medicinal chemistry as a scaffold for the design and optimization of new drug candidates. Its structural features can be modified to explore various chemical space and identify compounds with enhanced pharmacological properties, such as increased potency, selectivity, and reduced side effects.
Note: The specific applications and industries mentioned above are hypothetical and based on the general potential of quinazoline derivatives in pharmaceutical research. The actual uses of 1,2-Dihydro-2-(5-nitro-2-thienyl)quinazoline-4-one would depend on the results of further research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 33389-33-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,3,8 and 9 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 33389-33:
(7*3)+(6*3)+(5*3)+(4*8)+(3*9)+(2*3)+(1*3)=122
122 % 10 = 2
So 33389-33-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H9N3O3S/c16-12-7-3-1-2-4-8(7)13-11(14-12)9-5-6-10(19-9)15(17)18/h1-6,11,13H,(H,14,16)
