33537-97-2 Usage
Uses
Used in Pharmaceutical Industry:
6-Chloro-1,2,3,4-tetrahydro-isoquinoline hydrochloride is used as an intermediate compound for the synthesis of various pharmaceutical drugs. Its unique structure and reactivity make it a valuable building block in the development of new medications, particularly those targeting neurological disorders or pain management.
Used in Chemical Research:
In the field of chemical research, 6-chloro-1,2,3,4-tetrahydro-isoquinoline hydrochloride serves as a model compound for studying the properties and reactions of isoquinolines. Its multi-functionality allows researchers to explore its potential in various chemical transformations and to understand the underlying mechanisms of these reactions.
Used in Material Science:
6-Chloro-1,2,3,4-tetrahydro-isoquinoline hydrochloride is used as a component in the development of new materials with specific properties. Its incorporation into polymers or other materials can lead to the creation of novel compounds with enhanced characteristics, such as improved conductivity or increased stability.
Check Digit Verification of cas no
The CAS Registry Mumber 33537-97-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,5,3 and 7 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 33537-97:
(7*3)+(6*3)+(5*5)+(4*3)+(3*7)+(2*9)+(1*7)=122
122 % 10 = 2
So 33537-97-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H10ClN.ClH/c10-9-2-1-7-3-4-11-6-8(7)5-9;/h1-2,5,11H,3-4,6H2;1H
33537-97-2Relevant articles and documents
Method for preparing tetrahydroisoquinolines
-
, (2008/06/13)
A method for preparing 1,2,3,4-tetrahydroisoquinolines comprising heating N-halo or hydroxyethyl-N-benzylamines in an aluminum chloride melt at 160°-210°.