33564-68-0 Usage
Uses
Used in Pharmaceutical Industry:
4-Bromo-2,3,5,6-tetrafluorotoluene is used as a key intermediate in the synthesis of pharmaceuticals for its ability to be readily incorporated into complex molecular structures, contributing to the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Bromo-2,3,5,6-tetrafluorotoluene serves as an intermediate in the production of agrochemicals, helping to create compounds that can protect crops and enhance agricultural productivity.
Used in Specialty Polymers Production:
4-Bromo-2,3,5,6-tetrafluorotoluene is utilized in the manufacturing of specialty polymers, where its unique properties can enhance the performance characteristics of the resulting materials, such as their thermal stability and chemical resistance.
Used as a Reagent in Organic Synthesis:
4-Bromo-2,3,5,6-tetrafluorotoluene acts as a common reagent in organic synthesis, facilitating a wide range of chemical reactions due to its reactivity, thus playing a crucial role in the preparation of various organic compounds.
Used as a Solvent in Chemical Reactions:
4-Bromo-2,3,5,6-tetrafluorotoluene is also employed as a solvent in different chemical processes, providing a medium that supports the desired reactions to take place efficiently.
Given its potential hazards and high reactivity, 4-Bromo-2,3,5,6-tetrafluorotoluene requires careful handling and proper safety measures during its use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 33564-68-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,5,6 and 4 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 33564-68:
(7*3)+(6*3)+(5*5)+(4*6)+(3*4)+(2*6)+(1*8)=120
120 % 10 = 0
So 33564-68-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H3BrF4/c1-2-4(9)6(11)3(8)7(12)5(2)10/h1H3
