3357-01-5 Usage
Uses
Used in Pharmaceutical Industry:
3-Isoxazolecarboxylic acid, 5-chloro-4-methyl-(7CI,9CI) is used as an intermediate in the synthesis of various pharmaceuticals for its potential biological activity. The presence of the chloro and methyl groups in its structure allows for the development of new drugs with improved properties, such as enhanced efficacy, selectivity, and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical industry, 3-Isoxazolecarboxylic acid, 5-chloro-4-methyl-(7CI,9CI) is utilized as a building block for the creation of new agrochemicals. Its unique structure and potential biological activity make it a valuable component in the development of novel pesticides, herbicides, and other agricultural products that can effectively control pests and diseases while minimizing environmental impact.
Used in Medicinal Chemistry Research:
3-Isoxazolecarboxylic acid, 5-chloro-4-methyl-(7CI,9CI) serves as a subject of interest in medicinal chemistry research. Its unique structure and potential biological activity make it a promising candidate for the development of new therapeutic agents. Researchers can explore its interactions with various biological targets, such as enzymes, receptors, and ion channels, to understand its mechanism of action and optimize its properties for specific medical applications.
Used in Agricultural Science Research:
In agricultural science, 3-Isoxazolecarboxylic acid, 5-chloro-4-methyl-(7CI,9CI) is a target for research aimed at developing innovative agrochemicals. Its unique structure and potential biological activity can be harnessed to create new pesticides, herbicides, and other agricultural products that offer improved performance, selectivity, and reduced environmental impact. Researchers can investigate its interactions with target pests and diseases, as well as its potential effects on non-target organisms and ecosystems, to ensure the development of safe and effective agricultural solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 3357-01-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,5 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 3357-01:
(6*3)+(5*3)+(4*5)+(3*7)+(2*0)+(1*1)=75
75 % 10 = 5
So 3357-01-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H4ClNO3/c1-2-3(5(8)9)7-10-4(2)6/h1H3,(H,8,9)
