3358-89-2 Usage
Uses
Used in Pharmaceutical Industry:
2,3,4,5,6,7-Hexahydro-2-methyl-7-(4-methylphenyl)-1,2-oxazepine is used as a potential pharmaceutical compound for the development of new medications for various conditions. Its unique structure and the presence of functional groups may contribute to its biological activity and therapeutic effects.
As the provided materials do not specify the exact applications or industries where 2,3,4,5,6,7-Hexahydro-2-methyl-7-(4-methylphenyl)-1,2-oxazepine is used, the above usage is a general statement based on its potential pharmaceutical uses. Further research and testing are required to determine its specific applications and effects in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 3358-89-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,5 and 8 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 3358-89:
(6*3)+(5*3)+(4*5)+(3*8)+(2*8)+(1*9)=102
102 % 10 = 2
So 3358-89-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO/c1-11-6-8-12(9-7-11)13-5-3-4-10-14(2)15-13/h6-9,13H,3-5,10H2,1-2H3
