33611-85-7 Usage
General Description
The chemical "(2S)-2-[[(4S)-4-[[(4S)-4-[[(4S)-4-[[(4S)-4-[[4-[(2-amino-4-oxo-1H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxy-butanoyl]amino]-4-carboxy-butanoyl]amino]-4-carboxy-butanoyl]amino]-4-carboxy-butanoyl]amino]pentanedioic acid" is a long peptide composed of a series of amino acids. It contains multiple repeating units of 4-[[(4S)-4-[[4-[(2-amino-4-oxo-1H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxy-butanoyl]amino]-4-carboxy-butanoyl, and the overall structure is a complex and highly specific arrangement of amino acids. This molecule is likely to be a peptide with a specific biological function, given its highly structured and repetitive nature.
Check Digit Verification of cas no
The CAS Registry Mumber 33611-85-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,6,1 and 1 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 33611-85:
(7*3)+(6*3)+(5*6)+(4*1)+(3*1)+(2*8)+(1*5)=97
97 % 10 = 7
So 33611-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C39H47N11O18/c40-39-49-31-30(33(58)50-39)43-19(16-42-31)15-41-18-3-1-17(2-4-18)32(57)48-24(38(67)68)8-13-28(54)46-22(36(63)64)6-11-26(52)44-20(34(59)60)5-10-25(51)45-21(35(61)62)7-12-27(53)47-23(37(65)66)9-14-29(55)56/h1-4,16,20-24,41H,5-15H2,(H,44,52)(H,45,51)(H,46,54)(H,47,53)(H,48,57)(H,55,56)(H,59,60)(H,61,62)(H,63,64)(H,65,66)(H,67,68)(H3,40,42,49,50,58)