33639-80-4 Usage
Description
2-ACETAMIDO-2-DEOXY-6-O-(ALPHA-L-FUCOPYRANOSYL)-D-GLUCOPYRANOSE is a complex oligosaccharide that plays a crucial role in cell adhesion between bacterial and eukaryotic cells. It is a white to off-white solid with unique chemical properties that make it valuable in various applications across different industries.
Uses
Used in Pharmaceutical Industry:
2-ACETAMIDO-2-DEOXY-6-O-(ALPHA-L-FUCOPYRANOSYL)-D-GLUCOPYRANOSE is used as a therapeutic agent for enhancing cell adhesion and communication between bacterial and eukaryotic cells. Its ability to facilitate cell adhesion makes it a promising candidate for the development of new drugs targeting bacterial infections and promoting healthy cell interactions.
Used in Biotechnology Industry:
In the biotechnology sector, 2-ACETAMIDO-2-DEOXY-6-O-(ALPHA-L-FUCOPYRANOSYL)-D-GLUCOPYRANOSE is utilized as a key component in the development of novel drug delivery systems. Its unique properties allow for the targeted delivery of therapeutic agents to specific cells, improving the efficacy and reducing the side effects of various treatments.
Used in Research and Development:
2-ACETAMIDO-2-DEOXY-6-O-(ALPHA-L-FUCOPYRANOSYL)-D-GLUCOPYRANOSE is also used as a vital research tool in the study of cell adhesion, bacterial interactions, and the development of new therapeutic strategies. Its role in cell adhesion makes it an essential compound for understanding the underlying mechanisms of various diseases and the potential for new treatments.
Used in Diagnostics:
2-ACETAMIDO-2-DEOXY-6-O-(ALPHA-L-FUCOPYRANOSYL)-D-GLUCOPYRANOSE can be employed in the development of diagnostic tools and tests to detect and monitor bacterial and eukaryotic cell interactions. Its presence in cell adhesion processes can serve as a biomarker for specific conditions, aiding in the early detection and treatment of various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 33639-80-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,6,3 and 9 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 33639-80:
(7*3)+(6*3)+(5*6)+(4*3)+(3*9)+(2*8)+(1*0)=124
124 % 10 = 4
So 33639-80-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H25NO10/c1-4-8(17)11(20)12(21)14(24-4)23-3-6-9(18)10(19)7(13(22)25-6)15-5(2)16/h4,6-14,17-22H,3H2,1-2H3,(H,15,16)/t4?,6?,7-,8+,9+,10+,11-,12-,13+,14+/m0/s1
33639-80-4Relevant articles and documents
SYNTHESIS OF PHENYL 2-ACETAMIDO-2-DEOXY-4-O-α-L-FUCOPYRANOSYL-β-D-GLUCOPYRANOSIDE AND p-NITROPHENYL 2-ACETAMIDO-2-DEOXY-6-O-α-L-FUCOPYRANOSYL-β-D-GLUCOPYRANOSIDE
Rana, Surjit S.,Barlow, Joseph J.,Matta, Khushi L.
, p. 245 - 254 (2007/10/02)
The reaction of phenyl 2-acetamido-3,6-di-O-acetyl-3-deoxy-β-D-glucopyranoside with 2,3,4-tri-O-benzyl-α-L-fucopyranosyl bromide (catalyzed by bromide ion) proceeded readly, to give the protected 4-O-substitued α-L-fucopyranosyl derivative wich, on O-deac