336879-99-3 Usage
Uses
Used in Pharmaceutical Industry:
3-[(2-CHLORO-6-FLUOROBENZYL)OXY]BENZALDEHYDE is used as a building block for the synthesis of various organic compounds, particularly in the development of new pharmaceutical agents. Its unique structure allows for the creation of diverse chemical entities with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 3-[(2-CHLORO-6-FLUOROBENZYL)OXY]BENZALDEHYDE serves as a key intermediate in the synthesis of agrochemicals, including pesticides and herbicides. Its chemical properties enable the production of effective compounds for crop protection and management.
Used in Coordination Chemistry:
3-[(2-CHLORO-6-FLUOROBENZYL)OXY]BENZALDEHYDE has been studied for its potential use as a ligand in coordination chemistry. Its ability to form stable complexes with metal ions makes it a valuable component in the design of new coordination compounds with specific properties and applications.
Used in Preparation of Functional Materials:
3-[(2-CHLORO-6-FLUOROBENZYL)OXY]BENZALDEHYDE also serves as a precursor in the preparation of functional materials, such as polymers, coatings, and sensors. The presence of both chloro and fluoro groups in its structure contributes to the development of materials with unique characteristics and improved performance in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 336879-99-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,6,8,7 and 9 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 336879-99:
(8*3)+(7*3)+(6*6)+(5*8)+(4*7)+(3*9)+(2*9)+(1*9)=203
203 % 10 = 3
So 336879-99-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H10ClFO2/c15-13-5-2-6-14(16)12(13)9-18-11-4-1-3-10(7-11)8-17/h1-8H,9H2
