33716-82-4 Usage
Uses
Used in Pharmaceutical Industry:
3,5'-Dimethyl-5-methoxy-(2,3'-oxybisphenol) is used as a pharmaceutical compound for its potential therapeutic effects. Its unique structure allows it to interact with specific biological targets, making it a candidate for the development of new drugs.
Used in Chemical Synthesis:
In the field of chemical synthesis, 3,5'-Dimethyl-5-methoxy-(2,3'-oxybisphenol) serves as a key intermediate or building block for the creation of more complex molecules. Its versatile structure can be further modified to produce a range of derivatives with specific applications.
Used in Material Science:
3,5'-Dimethyl-5-methoxy-(2,3'-oxybisphenol) is used as a component in the development of advanced materials, such as polymers and composites, due to its ability to influence the properties of these materials. Its incorporation can lead to improved mechanical, thermal, or electrical characteristics.
Used in Agrochemical Industry:
3,5'-Dimethyl-5-methoxy-(2,3'-oxybisphenol) is used as a herbicide, similar to the natural product Cyperin, which is isolated from Preussia fleischhakii. As a protoporphyrinogen oxidase inhibitor, it can effectively control the growth of unwanted plants, making it a valuable tool in agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 33716-82-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,7,1 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 33716-82:
(7*3)+(6*3)+(5*7)+(4*1)+(3*6)+(2*8)+(1*2)=114
114 % 10 = 4
So 33716-82-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H16O4/c1-9-4-11(16)7-13(5-9)19-15-10(2)6-12(18-3)8-14(15)17/h4-8,16-17H,1-3H3
33716-82-4Relevant academic research and scientific papers
SYNTHESIS AND HERBICIDAL ACTIVITY OF CYPERIN
Harrington, Philip M.,Singh, Bijay K.,Szamosi, Iwona T.,Birk, Jeffrey H.
, p. 804 - 808 (2007/10/02)
Cyperin is a phytotoxic diphenyl ether natural product.Total synthesis of cyperin has been achieved and its herbicidal activity evaluated.The synthesis is highlighted by an Ullmann coupling to construct the diphenyl ether moiety contained within cyperin.I
