337487-27-1 Usage
Uses
Used in Pharmaceutical Industry:
(4-CYCLOHEXYL-5-FURAN-2-YL-4 H-[1,2,4]TRIAZOL-3-YLSULFANYL)-ACETIC ACID is used as a potential pharmaceutical candidate due to its complex structure and the presence of the triazole ring, which is known to be a common structural motif in many biologically active compounds. (4-CYCLOHEXYL-5-FURAN-2-YL-4 H-[1,2,4]TRIAZOL-3-YLSULFANYL)-ACETIC ACID's ability to interact with biological systems may contribute to its development as a new drug or therapeutic agent.
Used in Research and Development:
(4-CYCLOHEXYL-5-FURAN-2-YL-4 H-[1,2,4]TRIAZOL-3-YLSULFANYL)-ACETIC ACID is used as a subject of research for understanding its interactions with biological systems and exploring its potential applications in drug development. The presence of the furan ring and cyclohexyl group may provide insights into its binding properties and mechanisms of action, which could be valuable for the design of new pharmaceuticals.
Used in Industrial Applications:
(4-CYCLOHEXYL-5-FURAN-2-YL-4 H-[1,2,4]TRIAZOL-3-YLSULFANYL)-ACETIC ACID may have potential uses in various industrial applications, such as the development of new materials or chemical processes, due to its unique structure and functional groups. (4-CYCLOHEXYL-5-FURAN-2-YL-4 H-[1,2,4]TRIAZOL-3-YLSULFANYL)-ACETIC ACID's properties could be harnessed for specific purposes, such as catalysis or the creation of new chemical entities with desired characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 337487-27-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,7,4,8 and 7 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 337487-27:
(8*3)+(7*3)+(6*7)+(5*4)+(4*8)+(3*7)+(2*2)+(1*7)=171
171 % 10 = 1
So 337487-27-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H17N3O3S/c18-12(19)9-21-14-16-15-13(11-7-4-8-20-11)17(14)10-5-2-1-3-6-10/h4,7-8,10H,1-3,5-6,9H2,(H,18,19)/p-1
